Infobox drug/testcases | |
| Pronunciation | /njuːˈməʊniə/ |
|---|
| Other names | 3{[(4-cyclopentyl-1-piperazinyl)imino]methyl}rifamycin |
|---|
| AHFS/Drugs.com | Monograph |
|---|
| MedlinePlus | a602026 |
|---|
| ATC code | |
|---|
|
| Bioavailability | increases when administered with food |
|---|
| Onset of action | 1 hr |
|---|
|
(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z,26E)-26-{[(4-cyclopentylpiperazin-1-yl)amino]methylidene}-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23,27-trioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(28),2,4,9,19,21,25(29)-heptaen-13-yl acetate
| | CAS Number | |
|---|
| PubChem CID | |
|---|
| DrugBank | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEBI | |
|---|
| ChEMBL | |
|---|
| NIAID ChemDB | |
|---|
|
| Formula | C47H64N4O12 |
|---|
| Molar mass | 877.031 g/mol |
|---|
| 3D model (JSmol) | |
|---|
CC(=O)O[C@H]3[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)\C=C\C=C(\C)C(=O)Nc6c(/C=N/N1CCN(CC1)C2CCCC2)c(O)c5c4C(=O)[C@@](C)(O/C=C/[C@H](OC)[C@H]3C)Oc4c(C)c(O)c5c6O
|
InChI=1S/C47H64N4O12/c1-24-13-12-14-25(2)46(59)49-37-32(23-48-51-20-18-50(19-21-51)31-15-10-11-16-31)41(56)34-35(42(37)57)40(55)29(6)44-36(34)45(58)47(8,63-44)61-22-17-33(60-9)26(3)43(62-30(7)52)28(5)39(54)27(4)38(24)53/h12-14,17,22-24,26-28,31,33,38-39,43,53-57H,10-11,15-16,18-21H2,1-9H3,(H,49,59)/b13-12+,22-17+,25-14-,48-23+/t24-,26+,27+,28+,33-,38-,39+,43+,47-/m0/s1 YCommenting here [1]Key:WDZCUPBHRAEYDL-GZAUEHORSA-N Y
| N Y (what is this?) (verify) | |
Infobox drug/testcases | |
| Pronunciation | /njuːˈməʊniə/ |
|---|
| Other names | 3{[(4-cyclopentyl-1-piperazinyl)imino]methyl}rifamycin |
|---|
| AHFS/Drugs.com | Monograph |
|---|
| MedlinePlus | a602026 |
|---|
| ATC code | |
|---|
|
| Bioavailability | increases when administered with food |
|---|
| Onset of action | 1 hr |
|---|
|
(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z,26E)-26-{[(4-cyclopentylpiperazin-1-yl)amino]methylidene}-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23,27-trioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(28),2,4,9,19,21,25(29)-heptaen-13-yl acetate
| | CAS Number | |
|---|
| PubChem CID | |
|---|
| DrugBank | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEBI | |
|---|
| ChEMBL | |
|---|
| NIAID ChemDB | |
|---|
|
| Formula | C47H64N4O12 |
|---|
| Molar mass | 877.031 g/mol |
|---|
| 3D model (JSmol) | |
|---|
CC(=O)O[C@H]3[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)\C=C\C=C(\C)C(=O)Nc6c(/C=N/N1CCN(CC1)C2CCCC2)c(O)c5c4C(=O)[C@@](C)(O/C=C/[C@H](OC)[C@H]3C)Oc4c(C)c(O)c5c6O
|
InChI=1S/C47H64N4O12/c1-24-13-12-14-25(2)46(59)49-37-32(23-48-51-20-18-50(19-21-51)31-15-10-11-16-31)41(56)34-35(42(37)57)40(55)29(6)44-36(34)45(58)47(8,63-44)61-22-17-33(60-9)26(3)43(62-30(7)52)28(5)39(54)27(4)38(24)53/h12-14,17,22-24,26-28,31,33,38-39,43,53-57H,10-11,15-16,18-21H2,1-9H3,(H,49,59)/b13-12+,22-17+,25-14-,48-23+/t24-,26+,27+,28+,33-,38-,39+,43+,47-/m0/s1 YCommenting here [1]Key:WDZCUPBHRAEYDL-GZAUEHORSA-N Y
| N Y (what is this?) (verify) | |