සැකිල්ල:Infobox drug/testcases11
![]() | This is the template test cases page for the sandbox of සැකිල්ල:Infobox drug. Purge this page to update the examples. If there are many examples of a complicated template, later ones may break due to limits in MediaWiki, see the HTML comment "NewPP limit report" in the rendered page. You can also use Special:ExpandTemplates to examine the results of template uses. You can test how this page looks in the different skins with these links: |
- Merge into (2017)
- Add gene therapy section (2018)
This testcase page uses {{Infobox drug/sandbox}}. Diff: සැකිල්ල:DiffPages.
- Testing Gene therapy
- Diff: සැකිල්ල:DiffPages.
- Has (data page)
- Template:Infobox drug/testcases11 (data page)
- This page has a data page to test this situation. (example: Caffeine has Caffeine (data page))
(data page)[සංස්කරණය]
- Jan 2022:
|data page=
- This testpage has DP: Template:Infobox drug/testcases11 (data page)
- (new) {{Infobox drug/data page link}}
|data page=
absent (dflt)
{{Infobox drug}}
|data page=<blank>
{{Infobox drug}}
|data page=Water (data page)
{{Infobox drug}}
|data page=[[Water (data page)]]
{{Infobox drug}}
|data page=none
{{Infobox drug}}
other older[සංස්කරණය]
|data page=Water (data page)
{{Infobox drug}}
|dat_ page=Foobar (xyz page)
{{Infobox drug}}
Gene therapy[සංස්කරණය]
- Pilot article is Voretigene neparvovec
{{Infobox drug}}
- 2
{{Infobox drug}}
Testcase 1[සංස්කරණය]
- Testcase comparing the previous template (now deprecated)
nowiki
|
---|
{| style="vertical-align:top" |- | colspan=2 | [[Oxytocin]] |- | {{tl|Infobox drug/sandbox}} | {{tl|Infobox neurohormone}} |- |{{Infobox drug/sandbox | type= | drug_name = Oxytocin (hormone) | IUPAC_name = 1-({(4''R'',7''S'',10''S'',13''S'',16''S'',19''R'')-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-16-(4-hydroxybenzyl)-13-[(1''S'')-1-methylpropyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl}carbonyl)-<small>L</small>-prolyl-<small>L</small>-leucylglycinamide | image = Oxytocin with labels.png | width = 250px <!-- Physiology --> | source_tissues = [[posterior pituitary]] | target_tissues = [[central nervous system]] | receptors = [[oxytocin receptor]] | agonists = [[carbetocin]], [[demoxytocin]], [[merotocin]] | antagonists = [[atosiban]], [[epelsiban]], [[retosiban]] | precursor = [[Neurophysin I|oxytocin-neurophysin 1]] | biosynthesis = [[magnolysin]] | metabolism = [[oxytocinase]] | legal_US= blabla-test | class = clinicalclass <!--Pharmacokinetic data--> | bioavailability = | protein_bound = 30% <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N }} |{{Infobox neurohormone <!-- Nomenclature and image --> | name = Oxytocin (hormone) | alt = <!--alt text for screenreaders--> | IUPACName = 1-({(4''R'',7''S'',10''S'',13''S'',16''S'',19''R'')-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-16-(4-hydroxybenzyl)-13-[(1''S'')-1-methylpropyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl}carbonyl)-<small>L</small>-prolyl-<small>L</small>-leucylglycinamide | synonyms = | abbrev = <!--abbreviated name--> | image = Oxytocin with labels.png <!-- Neuropharmacology --> | sources = [[posterior pituitary]] | targets = [[central nervous system]] | receptors = [[oxytocin receptor]] | agonists = [[carbetocin]], [[demoxytocin]], [[merotocin]] | antagonists = [[atosiban]], [[epelsiban]], [[retosiban]] | precursor = [[Neurophysin I|oxytocin-neurophysin 1]] | synth = [[magnolysin]] | breakdown = [[oxytocinase]] <!-- Database links --> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N | footnotes = }} |} |
test metabolism in two sections[සංස්කරණය]
{{Infobox drug}}
{{Infobox drug}}
{{Infobox drug}}
{{Infobox drug}}
text metabolism, and pronunciation[සංස්කරණය]
nowiki
|
---|
{{tl|Infobox drug/sandbox}} {{testcase table | type= | drug_name = M. with physiological data only | IUPAC_name = | pronounce = {{IPAc-en|ˌ|ɒ|k|s|ᵻ|ˈ|t|oʊ|s|ɪ|n}} | image = Aspirin-skeletal.svg <!-- Physiology --> | source_tissues = [[posterior pituitary]] | target_tissues = [[central nervous system]] | receptors = [[oxytocin receptor]] | agonists = [[carbetocin]], [[demoxytocin]], [[merotocin]] | antagonists = [[atosiban]], [[epelsiban]], [[retosiban]] | precursor = [[Neurophysin I|oxytocin-neurophysin 1]] | biosynthesis = [[magnolysin]] | metabolism = [[oxytocinase]] <!--Pharmacokinetic data--> | bioavailability = | protein_bound = <!-- 30% --> <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N }} {{testcase table | type= | drug_name = M. with pharmacokinetic data only | IUPAC_name = | pronounce = {{IPAc-en|ˌ|ɒ|k|s|ᵻ|ˈ|t|oʊ|s|ɪ|n}} | image = Aspirin-skeletal.svg <!-- Physiology --> | metabolism = [[oxytocinase]] <!--Pharmacokinetic data--> | bioavailability = xyz | protein_bound = 30% <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N }} {{testcase table | type= | drug_name = M. with physio and pharmacokin data both | IUPAC_name = | pronounce = {{IPAc-en|ˌ|ɒ|k|s|ᵻ|ˈ|t|oʊ|s|ɪ|n}} | image = Aspirin-skeletal.svg <!-- Physiology --> | source_tissues = [[posterior pituitary]] | target_tissues = [[central nervous system]] | receptors = [[oxytocin receptor]] | agonists = [[carbetocin]], [[demoxytocin]], [[merotocin]] | antagonists = [[atosiban]], [[epelsiban]], [[retosiban]] | precursor = [[Neurophysin I|oxytocin-neurophysin 1]] | biosynthesis = [[magnolysin]] | metabolism = [[oxytocinase]] <!--Pharmacokinetic data--> | bioavailability = xyz | protein_bound = 30% <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N }} {{testcase table | type= | drug_name = M. with M. value only | IUPAC_name = | pronounce = {{IPAc-en|ˌ|ɒ|k|s|ᵻ|ˈ|t|oʊ|s|ɪ|n}} | image = Aspirin-skeletal.svg <!-- Physiology --> | source_tissues = | target_tissues = | receptors = | agonists = | antagonists = | precursor = | biosynthesis = | metabolism = [[oxytocinase]] <!--Pharmacokinetic data--> | bioavailability = | protein_bound = <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol }} |